Metadata-Version: 2.4
Name: molscrub
Version: 0.2.1
Summary: Enumerate states of small organic molecules: 3D coordinates, tautomers, pH-based adjustments
Home-page: https://github.com/forlilab/molscrub
Author: Forli Lab
Author-email: forli@scripps.edu
License: GPL-v3
Requires-Python: >=3.8
Description-Content-Type: text/markdown
License-File: LICENSE
Requires-Dist: rdkit>=2022.03.1
Dynamic: author
Dynamic: author-email
Dynamic: description
Dynamic: description-content-type
Dynamic: home-page
Dynamic: license
Dynamic: license-file
Dynamic: requires-dist
Dynamic: requires-python
Dynamic: summary

# Scrubber
Process large numbers of small molecules for docking with AutoDock.
May be useful for structure-based modeling in general.

What happens:
 - generate 3D coordinates using RDKit's ETKDGv3 and UFF minimization
 - enumerate tautomers (aiming at low energy states only)
 - enumerate pH corrections
 - convert boats to chairs (6-member rings) and enumerate both chair states
 - enumerate chiral centers (not implemented right now)


# Installation
```sh
conda activate <desired-environment>    # if you are using conda environments

git clone git@github.com:forlilab/molscrub.git
cd molscrub
pip install -e .
```

Depends on the RDKit, which can be installed from conda-forge in the desired environment:
```sh
conda activate <desired-environment>
conda install rdkit -c conda-forge
```

## Python scripting
```python
from rdkit import Chem
from molscrub import Scrub

scrub = Scrub(
    ph_low=7.4,
    ph_high=7.4,
)

mol = Chem.MolFromSmiles("Clc1c(OCCC3)c3ccc1C(=O)Nc2nc[nH]c2")

# each state (e.g. tautomer) an rdkit mol and may have multiple conformers
for mol_state in scrub(mol):
    print(Chem.MolToSmiles(mol_state), "nr conformers: %d" % mol_state.GetNumConformers())
```

## Command line tool examples
```sh
scrub.py "c1cc[nH]c(=O)c1" -o scrubbed.sdf --ph 5 --skip_gen3d
scrub.py input_mols.sdf -o scrubbed.sdf
scrub.py input_mols.smi -o scrubbed.sdf
```

Other options described in the help message:
```sh
scrub.py -h
```

Where "input\_mols.smi" can look like this:
```
CC(=O)O aceticacid
CN(C)C trimethylamine 
Clc1cc(O)ccc1C(=O)Nc2nc[nH]c2 hello_mol
c1cccc1 rdkit_will_cry
CCC good4bbq
CCO alsogood4bbq
c1cccnc1CC(=O)C a_ketone
```
