Metadata-Version: 2.3
Name: chiralfinder
Version: 0.0.2
Summary: The chiralfinder package.
License: MIT
Keywords: Chirality,Chiral axis
Author: Runhan Shi
Author-email: han.run.jiangming@sjtu.edu.cn
Maintainer: Runhan Shi
Maintainer-email: han.run.jiangming@sjtu.edu.cn
Requires-Python: >=3.8,<4.0
Classifier: License :: OSI Approved :: MIT License
Classifier: Programming Language :: Python :: 3
Classifier: Programming Language :: Python :: 3.8
Classifier: Programming Language :: Python :: 3.9
Classifier: Programming Language :: Python :: 3.10
Classifier: Programming Language :: Python :: 3.11
Classifier: Programming Language :: Python :: 3.12
Classifier: Programming Language :: Python :: 3.13
Requires-Dist: numpy (>=1.26.4,<2.0.0)
Requires-Dist: rdkit (>=2024.3.3,<2025.0.0)
Requires-Dist: tqdm (>=4.65.0,<5.0.0)
Project-URL: Documentation, https://github.com/Meteor-han/chiralfinder/
Project-URL: Homepage, https://github.com/Meteor-han/chiralfinder/
Project-URL: Repository, https://github.com/Meteor-han/chiralfinder/
Project-URL: issues, https://github.com/Meteor-han/chiralfinder/issues
Description-Content-Type: text/markdown

# chiralfinder

Data and codes for the paper "A Unifying Geometric Framework for Computational Representation of Stereoisomers Based on Mixed Product", in submission.

## Quick use

Install Anaconda, create and enter your own environment like

    conda create -n env_test python=3.10
Enter the conda environment and install the ChiralFinder package through pip like

```
conda activate env_test
pip install chiralfinder
```

Run `test.py` to get example results.

```
python test.py
```

```python
from chiralfinder import ChiralFinder

if __name__ == '__main__':
    smi_list = ["C[C@H]1CC(=O)[C@]2(CCCC2=O)C1", "CC1=CC=C(SC2=C(C)N(C3=CC=CC=C3C(C)(C)C)C(C)=C2)C=C1"]

    chiral_finder = ChiralFinder(smi_list, "SMILES")
    res_ = chiral_finder.get_axial(n_cpus=8)
    print(res_[0]["chiral axes"], res_[1]["chiral axes"])
    chiral_finder.draw_res_axial("./img")

    smi_list_center = ["BrC/C(=C\[C@@H]1CCCO1)C1CCCCC1"]
    chiral_finder = ChiralFinder(smi_list_center, "SMILES")
    res_ = chiral_finder.get_central()
    print(res_)
```

You will get the images of two molecules with predicted chiral axes in the folder `./img` by default. Predicted chiral axes:

```
[(5,)] [(9, 10)]
```

<img src="https://github.com/Meteor-han/chiralfinder/blob/main/img_axial/0.png" alt="0" width="30%" height="auto" /><img src="https://github.com/Meteor-han/chiralfinder/blob/main/img_axial/1.png" alt="1"  width="30%" height="auto" />

You will get the prediction of one molecule for central chirality.

```
[{
'center id': [4], 
'quadrupole matrix': 
       [[array([[-0.29989323, -1.08474687,  0.09943544],
       [-2.0754821 ,  0.47857598,  1.02051223],
       [-0.0064714 , -0.03258116,  2.29906673]])]], 
'determinant': [[-5.501797575969392]], 
'norm CP': [[-0.8993660781912431]], 
'sign': [[-1.0]]
}]
```


## Dataset

The RotA dataset is stored in the folder `./data`. The excel file contains labeled chiral axes and some calculated molecular properties. The pickle file includes calculated molecular conformers.

We also provide sampled achiral molecules and centrally chiral molecules with multiple centers from the PubChem3D database in the folder `./data`.

## Citation

```
To be filled
```


